2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid

C11H16N2O3 — CID 115085637

IUPAC2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid
SMILESCCN1CCCC(c2ncc(C(=O)O)o2)C1
InChIInChI=1S/C11H16N2O3/c1-2-13-5-3-4-8(7-13)10-12-6-9(16-10)11(14)15/h6,8H,2-5,7H2,1H3,(H,14,15)
InChIKeyYOVSFNYNZLTOBI-UHFFFAOYSA-N
MW224.26 g/mol
LogP1.57
Rot. Bonds3

About 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid

2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 115085637) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid
PubChem CID115085637
Molecular FormulaC11H16N2O3
Molecular Weight224.26 g/mol
Exact Mass224.12
IUPAC Name2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid
SMILESCCN1CCCC(c2ncc(C(=O)O)o2)C1
InChIInChI=1S/C11H16N2O3/c1-2-13-5-3-4-8(7-13)10-12-6-9(16-10)11(14)15/h6,8H,2-5,7H2,1H3,(H,14,15)
InChIKeyYOVSFNYNZLTOBI-UHFFFAOYSA-N
XLogP1.57
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid (CID 115085637) is 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid is CCN1CCCC(c2ncc(C(=O)O)o2)C1.
What is the InChIKey of 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is YOVSFNYNZLTOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-2-13-5-3-4-8(7-13)10-12-6-9(16-10)11(14)15/h6,8H,2-5,7H2,1H3,(H,14,15).
What are the key properties of 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid?
2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 224.26 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethylpiperidin-3-yl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 115085637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).