C14H19N3O — CID 117139032
3-(1-ethylpiperidin-3-yl)imidazo[1,5-a]pyridin-6-ol (PubChem CID 117139032) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-3-yl)imidazo[1,5-a]pyridin-6-ol.
| Compound Name | 3-(1-ethylpiperidin-3-yl)imidazo[1,5-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117139032 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-(1-ethylpiperidin-3-yl)imidazo[1,5-a]pyridin-6-ol |
| SMILES | CCN1CCCC(c2ncc3ccc(O)cn23)C1 |
| InChI | InChI=1S/C14H19N3O/c1-2-16-7-3-4-11(9-16)14-15-8-12-5-6-13(18)10-17(12)14/h5-6,8,10-11,18H,2-4,7,9H2,1H3 |
| InChIKey | WQAWZTRKEZQAFP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |