2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid

C8H9NO3S — CID 115021666

IUPAC2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCSC2)o1
InChIInChI=1S/C8H9NO3S/c10-8(11)6-3-9-7(12-6)5-1-2-13-4-5/h3,5H,1-2,4H2,(H,10,11)
InChIKeyVBHUTNRPZZHSRM-UHFFFAOYSA-N
MW199.23 g/mol
LogP1.59
Rot. Bonds2

About 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid

2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 115021666) has the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. Its IUPAC name is 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid
PubChem CID115021666
Molecular FormulaC8H9NO3S
Molecular Weight199.23 g/mol
Exact Mass199.03
IUPAC Name2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCSC2)o1
InChIInChI=1S/C8H9NO3S/c10-8(11)6-3-9-7(12-6)5-1-2-13-4-5/h3,5H,1-2,4H2,(H,10,11)
InChIKeyVBHUTNRPZZHSRM-UHFFFAOYSA-N
XLogP1.59
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.23
LogP ≤ 51.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid (CID 115021666) is 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid is O=C(O)c1cnc(C2CCSC2)o1.
What is the InChIKey of 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is VBHUTNRPZZHSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c10-8(11)6-3-9-7(12-6)5-1-2-13-4-5/h3,5H,1-2,4H2,(H,10,11).
What are the key properties of 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid?
2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 199.23 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiolan-3-yl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 115021666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).