C9H12N2O2 — CID 115085669
1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanone (PubChem CID 115085669) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanone.
| Compound Name | 1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanone |
|---|---|
| PubChem CID | 115085669 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanone |
| SMILES | CC(=O)c1cnc(C2CCCN2)o1 |
| InChI | InChI=1S/C9H12N2O2/c1-6(12)8-5-11-9(13-8)7-3-2-4-10-7/h5,7,10H,2-4H2,1H3 |
| InChIKey | PESMSJDTSMPIBO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |