C11H16N2O2 — CID 115082929
1-(2-piperidin-2-yl-1,3-oxazol-4-yl)propan-2-one (PubChem CID 115082929) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(2-piperidin-2-yl-1,3-oxazol-4-yl)propan-2-one.
| Compound Name | 1-(2-piperidin-2-yl-1,3-oxazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 115082929 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(2-piperidin-2-yl-1,3-oxazol-4-yl)propan-2-one |
| SMILES | CC(=O)Cc1coc(C2CCCCN2)n1 |
| InChI | InChI=1S/C11H16N2O2/c1-8(14)6-9-7-15-11(13-9)10-4-2-3-5-12-10/h7,10,12H,2-6H2,1H3 |
| InChIKey | FTGORZNGBGLUFW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |