C11H19N3O — CID 115082989
N-methyl-2-(2-piperidin-2-yl-1,3-oxazol-4-yl)ethanamine (PubChem CID 115082989) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-methyl-2-(2-piperidin-2-yl-1,3-oxazol-4-yl)ethanamine.
| Compound Name | N-methyl-2-(2-piperidin-2-yl-1,3-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 115082989 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-methyl-2-(2-piperidin-2-yl-1,3-oxazol-4-yl)ethanamine |
| SMILES | CNCCc1coc(C2CCCCN2)n1 |
| InChI | InChI=1S/C11H19N3O/c1-12-7-5-9-8-15-11(14-9)10-4-2-3-6-13-10/h8,10,12-13H,2-7H2,1H3 |
| InChIKey | CCIOKIZJSOQNFS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |