C15H25N3O2 — CID 3433625
N-heptyl-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 3433625) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-heptyl-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-heptyl-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3433625 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-heptyl-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCCNC(=O)c1coc(C2CCCN2)n1 |
| InChI | InChI=1S/C15H25N3O2/c1-2-3-4-5-6-9-17-14(19)13-11-20-15(18-13)12-8-7-10-16-12/h11-12,16H,2-10H2,1H3,(H,17,19) |
| InChIKey | SXUPGPVRKSMEBA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|