C10H16N2O2 — CID 92615014
2-[3-[(2R)-piperidin-2-yl]-1,2-oxazol-5-yl]ethanol (PubChem CID 92615014) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[3-[(2R)-piperidin-2-yl]-1,2-oxazol-5-yl]ethanol.
| Compound Name | 2-[3-[(2R)-piperidin-2-yl]-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 92615014 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-[3-[(2R)-piperidin-2-yl]-1,2-oxazol-5-yl]ethanol |
| SMILES | OCCc1cc([C@H]2CCCCN2)no1 |
| InChI | InChI=1S/C10H16N2O2/c13-6-4-8-7-10(12-14-8)9-3-1-2-5-11-9/h7,9,11,13H,1-6H2/t9-/m1/s1 |
| InChIKey | RJQSJCLEFMNLBR-SECBINFHSA-N |
| XLogP | 1.02 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |