C17H25N3O6 — CID 20610269
diethyl 2-acetamido-2-[(3-pyrrolidin-2-yl-1,2-oxazol-5-yl)methyl]propanedioate (PubChem CID 20610269) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(3-pyrrolidin-2-yl-1,2-oxazol-5-yl)methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(3-pyrrolidin-2-yl-1,2-oxazol-5-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 20610269 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | diethyl 2-acetamido-2-[(3-pyrrolidin-2-yl-1,2-oxazol-5-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cc(C2CCCN2)no1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C17H25N3O6/c1-4-24-15(22)17(19-11(3)21,16(23)25-5-2)10-12-9-14(20-26-12)13-7-6-8-18-13/h9,13,18H,4-8,10H2,1-3H3,(H,19,21) |
| InChIKey | HWQGEQMAWXKDIX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|