C16H18N2O3 — CID 92571981
3-[(2S)-azepan-2-yl]-5-(1,3-benzodioxol-5-yl)-1,2-oxazole (PubChem CID 92571981) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[(2S)-azepan-2-yl]-5-(1,3-benzodioxol-5-yl)-1,2-oxazole.
| Compound Name | 3-[(2S)-azepan-2-yl]-5-(1,3-benzodioxol-5-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 92571981 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3-[(2S)-azepan-2-yl]-5-(1,3-benzodioxol-5-yl)-1,2-oxazole |
| SMILES | c1cc2c(cc1-c1cc([C@@H]3CCCCCN3)no1)OCO2 |
| InChI | InChI=1S/C16H18N2O3/c1-2-4-12(17-7-3-1)13-9-15(21-18-13)11-5-6-14-16(8-11)20-10-19-14/h5-6,8-9,12,17H,1-4,7,10H2/t12-/m0/s1 |
| InChIKey | DRZXMKVBTJXTMR-LBPRGKRZSA-N |
| XLogP | 3.28 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |