C24H26N2O5 — CID 110219940
2-[[2-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]azepan-1-yl]methyl]-5-methoxyphenol (PubChem CID 110219940) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[[2-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]azepan-1-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[2-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]azepan-1-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 110219940 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[[2-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]azepan-1-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCCCCC2c2cc(-c3ccc4c(c3)OCO4)on2)c(O)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-28-18-8-6-17(21(27)12-18)14-26-10-4-2-3-5-20(26)19-13-23(31-25-19)16-7-9-22-24(11-16)30-15-29-22/h6-9,11-13,20,27H,2-5,10,14-15H2,1H3 |
| InChIKey | YGDPKRDUPAIFOA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|