C15H18N2O2 — CID 92732581
2-[[(2R)-2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol (PubChem CID 92732581) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[[(2R)-2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 2-[[(2R)-2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 92732581 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[[(2R)-2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol |
| SMILES | Cc1cc([C@H]2CCCN2Cc2ccccc2O)no1 |
| InChI | InChI=1S/C15H18N2O2/c1-11-9-13(16-19-11)14-6-4-8-17(14)10-12-5-2-3-7-15(12)18/h2-3,5,7,9,14,18H,4,6,8,10H2,1H3/t14-/m1/s1 |
| InChIKey | OGENIJKMAYPJBK-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|