C18H24N2O3 — CID 92732084
5-methoxy-2-[[(2R)-2-(5-propan-2-yl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol (PubChem CID 92732084) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-methoxy-2-[[(2R)-2-(5-propan-2-yl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 5-methoxy-2-[[(2R)-2-(5-propan-2-yl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 92732084 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 5-methoxy-2-[[(2R)-2-(5-propan-2-yl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol |
| SMILES | COc1ccc(CN2CCC[C@@H]2c2cc(C(C)C)on2)c(O)c1 |
| InChI | InChI=1S/C18H24N2O3/c1-12(2)18-10-15(19-23-18)16-5-4-8-20(16)11-13-6-7-14(22-3)9-17(13)21/h6-7,9-10,12,16,21H,4-5,8,11H2,1-3H3/t16-/m1/s1 |
| InChIKey | DJEFCCIALOXIBG-MRXNPFEDSA-N |
| XLogP | 3.85 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|