C9H14N2O2S — CID 115079916
[3-(thian-4-ylmethyl)-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 115079916) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is [3-(thian-4-ylmethyl)-1,2,4-oxadiazol-5-yl]methanol.
| Compound Name | [3-(thian-4-ylmethyl)-1,2,4-oxadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 115079916 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | [3-(thian-4-ylmethyl)-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | OCc1nc(CC2CCSCC2)no1 |
| InChI | InChI=1S/C9H14N2O2S/c12-6-9-10-8(11-13-9)5-7-1-3-14-4-2-7/h7,12H,1-6H2 |
| InChIKey | TVCWEEPLQSTHJT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |