C7H12N2O2 — CID 43558836
(3-butyl-1,2,4-oxadiazol-5-yl)methanol (PubChem CID 43558836) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (3-butyl-1,2,4-oxadiazol-5-yl)methanol.
| Compound Name | (3-butyl-1,2,4-oxadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 43558836 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (3-butyl-1,2,4-oxadiazol-5-yl)methanol |
| SMILES | CCCCc1noc(CO)n1 |
| InChI | InChI=1S/C7H12N2O2/c1-2-3-4-6-8-7(5-10)11-9-6/h10H,2-5H2,1H3 |
| InChIKey | GGHUVKQOIHRJDT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |