C9H16N4O2 — CID 107436449
2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylamino]acetamide (PubChem CID 107436449) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylamino]acetamide.
| Compound Name | 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 107436449 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylamino]acetamide |
| SMILES | CCCCc1noc(CNCC(N)=O)n1 |
| InChI | InChI=1S/C9H16N4O2/c1-2-3-4-8-12-9(15-13-8)6-11-5-7(10)14/h11H,2-6H2,1H3,(H2,10,14) |
| InChIKey | RYCMTMUYKISIIQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |