About 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide
2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide (PubChem CID 107436380) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide |
| PubChem CID | 107436380 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide |
| SMILES | NC(=O)CNCc1nc(N)no1 |
| InChI | InChI=1S/C5H9N5O2/c6-3(11)1-8-2-4-9-5(7)10-12-4/h8H,1-2H2,(H2,6,11)(H2,7,10) |
| InChIKey | POOBJQBPWXTBPW-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide?
The IUPAC name of 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide (CID 107436380) is 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide.
What is the SMILES notation for 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide?
The canonical SMILES for 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide is NC(=O)CNCc1nc(N)no1.
What is the InChIKey of 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide?
The InChIKey is POOBJQBPWXTBPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c6-3(11)1-8-2-4-9-5(7)10-12-4/h8H,1-2H2,(H2,6,11)(H2,7,10).
What are the key properties of 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide?
2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide has a molecular weight of 171.16 g/mol, XLogP of -1.77, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-1,2,4-oxadiazol-5-yl)methylamino]acetamide is sourced from PubChem (CID 107436380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).