C5H8N4O2 — CID 107436055
2-(1,2,4-oxadiazol-5-ylmethylamino)acetamide (PubChem CID 107436055) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-5-ylmethylamino)acetamide.
| Compound Name | 2-(1,2,4-oxadiazol-5-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 107436055 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-(1,2,4-oxadiazol-5-ylmethylamino)acetamide |
| SMILES | NC(=O)CNCc1ncno1 |
| InChI | InChI=1S/C5H8N4O2/c6-4(10)1-7-2-5-8-3-9-11-5/h3,7H,1-2H2,(H2,6,10) |
| InChIKey | FQWCREZFOBDVQL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |