About N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine
N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine (PubChem CID 60722213) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine.
Analyze N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine?
The IUPAC name of N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine (CID 60722213) is N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine.
What is the SMILES notation for N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine?
The canonical SMILES for N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine is CCCc1noc(CNCC)n1.
What is the InChIKey of N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine?
The InChIKey is QIRPMRYGMGUXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-3-5-7-10-8(12-11-7)6-9-4-2/h9H,3-6H2,1-2H3.
What are the key properties of N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine?
N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine has a molecular weight of 169.23 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine is sourced from PubChem (CID 60722213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).