C6H9N5O — CID 61374395
5-(azidomethyl)-3-propyl-1,2,4-oxadiazole (PubChem CID 61374395) has the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. Its IUPAC name is 5-(azidomethyl)-3-propyl-1,2,4-oxadiazole.
| Compound Name | 5-(azidomethyl)-3-propyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 61374395 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 5-(azidomethyl)-3-propyl-1,2,4-oxadiazole |
| SMILES | CCCc1noc(CN=[N+]=[N-])n1 |
| InChI | InChI=1S/C6H9N5O/c1-2-3-5-9-6(12-10-5)4-8-11-7/h2-4H2,1H3 |
| InChIKey | WXLKPAJYRRKFLZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|