C7H11N5O — CID 165151786
3-(2-azidoethyl)-5-propan-2-yl-1,2,4-oxadiazole (PubChem CID 165151786) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 3-(2-azidoethyl)-5-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(2-azidoethyl)-5-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 165151786 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 3-(2-azidoethyl)-5-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1nc(CCN=[N+]=[N-])no1 |
| InChI | InChI=1S/C7H11N5O/c1-5(2)7-10-6(11-13-7)3-4-9-12-8/h5H,3-4H2,1-2H3 |
| InChIKey | KBNHNAUGYQZNHA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|