C7H12N2O3 — CID 102660353
[5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 102660353) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is [5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]methanol.
| Compound Name | [5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]methanol |
|---|---|
| PubChem CID | 102660353 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | [5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | CCOCCc1nc(CO)no1 |
| InChI | InChI=1S/C7H12N2O3/c1-2-11-4-3-7-8-6(5-10)9-12-7/h10H,2-5H2,1H3 |
| InChIKey | MJPIMXMYFZYLTH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|