C6H10N2O3 — CID 115076899
2-[5-(2-hydroxyethyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 115076899) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-[5-(2-hydroxyethyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-[5-(2-hydroxyethyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 115076899 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2-[5-(2-hydroxyethyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | OCCc1noc(CCO)n1 |
| InChI | InChI=1S/C6H10N2O3/c9-3-1-5-7-6(2-4-10)11-8-5/h9-10H,1-4H2 |
| InChIKey | UOSWSBCYWBWGTM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |