C6H8N2O3 — CID 115080406
2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde (PubChem CID 115080406) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde.
| Compound Name | 2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115080406 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1nc(CCO)no1 |
| InChI | InChI=1S/C6H8N2O3/c9-3-1-5-7-6(2-4-10)11-8-5/h4,9H,1-3H2 |
| InChIKey | RTODKADTOMKVOD-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|