C12H12N2O2 — CID 115080556
2-[3-[(3-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde (PubChem CID 115080556) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[3-[(3-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde.
| Compound Name | 2-[3-[(3-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115080556 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-[3-[(3-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde |
| SMILES | Cc1cccc(Cc2noc(CC=O)n2)c1 |
| InChI | InChI=1S/C12H12N2O2/c1-9-3-2-4-10(7-9)8-11-13-12(5-6-15)16-14-11/h2-4,6-7H,5,8H2,1H3 |
| InChIKey | GKIXSPWOVHQIJG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|