C11H9FN2O2 — CID 115080575
2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde (PubChem CID 115080575) has the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115080575 |
| Molecular Formula | C11H9FN2O2 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1nc(Cc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C11H9FN2O2/c12-9-3-1-8(2-4-9)7-10-13-11(5-6-15)16-14-10/h1-4,6H,5,7H2 |
| InChIKey | GCIAVGNLFPRNHE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|