C10H15N3O3 — CID 115080623
2-[3-(2-morpholin-4-ylethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde (PubChem CID 115080623) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[3-(2-morpholin-4-ylethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde.
| Compound Name | 2-[3-(2-morpholin-4-ylethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115080623 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-[3-(2-morpholin-4-ylethyl)-1,2,4-oxadiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1nc(CCN2CCOCC2)no1 |
| InChI | InChI=1S/C10H15N3O3/c14-6-2-10-11-9(12-16-10)1-3-13-4-7-15-8-5-13/h6H,1-5,7-8H2 |
| InChIKey | QBVCTKAPEHWPPP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|