C11H10N2O3 — CID 115078953
2-[5-[(2-hydroxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]acetaldehyde (PubChem CID 115078953) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[5-[(2-hydroxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]acetaldehyde.
| Compound Name | 2-[5-[(2-hydroxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 115078953 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-[5-[(2-hydroxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]acetaldehyde |
| SMILES | O=CCc1noc(Cc2ccccc2O)n1 |
| InChI | InChI=1S/C11H10N2O3/c14-6-5-10-12-11(16-13-10)7-8-3-1-2-4-9(8)15/h1-4,6,15H,5,7H2 |
| InChIKey | WZTOYHXXKLJKMC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|