About [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol
[5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 102660376) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol |
| PubChem CID | 102660376 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | COC(C)CCc1nc(CO)no1 |
| InChI | InChI=1S/C8H14N2O3/c1-6(12-2)3-4-8-9-7(5-11)10-13-8/h6,11H,3-5H2,1-2H3 |
| InChIKey | FBIJNJZSKOZZRR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol?
The IUPAC name of [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol (CID 102660376) is [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol.
What is the SMILES notation for [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol?
The canonical SMILES for [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol is COC(C)CCc1nc(CO)no1.
What is the InChIKey of [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol?
The InChIKey is FBIJNJZSKOZZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-6(12-2)3-4-8-9-7(5-11)10-13-8/h6,11H,3-5H2,1-2H3.
What are the key properties of [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol?
[5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol has a molecular weight of 186.21 g/mol, XLogP of 0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-methoxybutyl)-1,2,4-oxadiazol-3-yl]methanol is sourced from PubChem (CID 102660376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).