C10H18N2O3 — CID 65093742
4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]butan-2-ol (PubChem CID 65093742) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]butan-2-ol.
| Compound Name | 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]butan-2-ol |
|---|---|
| PubChem CID | 65093742 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]butan-2-ol |
| SMILES | COCCCc1noc(CCC(C)O)n1 |
| InChI | InChI=1S/C10H18N2O3/c1-8(13)5-6-10-11-9(12-15-10)4-3-7-14-2/h8,13H,3-7H2,1-2H3 |
| InChIKey | NQVLXFWWKRJEFP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|