C8H15N3O2 — CID 116799790
4-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]butan-2-ol (PubChem CID 116799790) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]butan-2-ol.
| Compound Name | 4-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]butan-2-ol |
|---|---|
| PubChem CID | 116799790 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]butan-2-ol |
| SMILES | CC(O)CCc1nc(N(C)C)no1 |
| InChI | InChI=1S/C8H15N3O2/c1-6(12)4-5-7-9-8(10-13-7)11(2)3/h6,12H,4-5H2,1-3H3 |
| InChIKey | WHCQXBRSYSIABH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |