C10H18N2O3 — CID 64534643
4-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]butan-2-ol (PubChem CID 64534643) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]butan-2-ol.
| Compound Name | 4-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]butan-2-ol |
|---|---|
| PubChem CID | 64534643 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]butan-2-ol |
| SMILES | CCOC(C)c1noc(CCC(C)O)n1 |
| InChI | InChI=1S/C10H18N2O3/c1-4-14-8(3)10-11-9(15-12-10)6-5-7(2)13/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | OGHVAWPDSFCWAD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |