About 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol
3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol (PubChem CID 79200735) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol.
Analyze 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol?
The IUPAC name of 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol (CID 79200735) is 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol.
What is the SMILES notation for 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol?
The canonical SMILES for 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol is CCOC(C)c1noc(CCCO)n1.
What is the InChIKey of 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol?
The InChIKey is ZQJXDZIJNMXWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-3-13-7(2)9-10-8(14-11-9)5-4-6-12/h7,12H,3-6H2,1-2H3.
What are the key properties of 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol?
3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol has a molecular weight of 200.24 g/mol, XLogP of 1.09, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]propan-1-ol is sourced from PubChem (CID 79200735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).