About 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine
5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 75481048) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
Analyze 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine (CID 75481048) is 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine is CN(C)c1noc(CCN)n1.
What is the InChIKey of 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
The InChIKey is AKBDWBZVAVSHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-10(2)6-8-5(3-4-7)11-9-6/h3-4,7H2,1-2H3.
What are the key properties of 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine has a molecular weight of 156.19 g/mol, XLogP of -0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 75481048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).