About 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine
2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 61412753) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine.
Analyze 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine?
The IUPAC name of 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine (CID 61412753) is 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine.
What is the SMILES notation for 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine?
The canonical SMILES for 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine is COCCc1noc(CCN)n1.
What is the InChIKey of 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine?
The InChIKey is VXBMCMXQXKCFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-11-5-3-6-9-7(2-4-8)12-10-6/h2-5,8H2,1H3.
What are the key properties of 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine?
2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine has a molecular weight of 171.20 g/mol, XLogP of -0.24, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanamine is sourced from PubChem (CID 61412753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).