C8H13ClN2O2 — CID 61412908
5-(3-chloropropyl)-3-(2-methoxyethyl)-1,2,4-oxadiazole (PubChem CID 61412908) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 5-(3-chloropropyl)-3-(2-methoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(3-chloropropyl)-3-(2-methoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 61412908 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-(3-chloropropyl)-3-(2-methoxyethyl)-1,2,4-oxadiazole |
| SMILES | COCCc1noc(CCCCl)n1 |
| InChI | InChI=1S/C8H13ClN2O2/c1-12-6-4-7-10-8(13-11-7)3-2-5-9/h2-6H2,1H3 |
| InChIKey | HHANDXDGLXZOQU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|