C9H15ClN2OS — CID 65134539
5-(3-chloropropyl)-3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazole (PubChem CID 65134539) has the molecular formula C9H15ClN2OS and a molecular weight of 234.75 g/mol. Its IUPAC name is 5-(3-chloropropyl)-3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(3-chloropropyl)-3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65134539 |
| Molecular Formula | C9H15ClN2OS |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-(3-chloropropyl)-3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazole |
| SMILES | CC(C)SCc1noc(CCCCl)n1 |
| InChI | InChI=1S/C9H15ClN2OS/c1-7(2)14-6-8-11-9(13-12-8)4-3-5-10/h7H,3-6H2,1-2H3 |
| InChIKey | VNLTZWHLVFAQKV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|