C11H17ClN2OS — CID 65141260
5-(3-chloropropyl)-3-(cyclopentylsulfanylmethyl)-1,2,4-oxadiazole (PubChem CID 65141260) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is 5-(3-chloropropyl)-3-(cyclopentylsulfanylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(3-chloropropyl)-3-(cyclopentylsulfanylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65141260 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-(3-chloropropyl)-3-(cyclopentylsulfanylmethyl)-1,2,4-oxadiazole |
| SMILES | ClCCCc1nc(CSC2CCCC2)no1 |
| InChI | InChI=1S/C11H17ClN2OS/c12-7-3-6-11-13-10(14-15-11)8-16-9-4-1-2-5-9/h9H,1-8H2 |
| InChIKey | VSIIGFJQPCGPQG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|