2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid

C8H12N2O3S — CID 65134331

IUPAC2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid
SMILESCC(C)SCc1noc(CC(=O)O)n1
InChIInChI=1S/C8H12N2O3S/c1-5(2)14-4-6-9-7(13-10-6)3-8(11)12/h5H,3-4H2,1-2H3,(H,11,12)
InChIKeyPLROFMFRCWQEPQ-UHFFFAOYSA-N
MW216.26 g/mol
LogP1.34
Rot. Bonds5

About 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid

2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 65134331) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid
PubChem CID65134331
Molecular FormulaC8H12N2O3S
Molecular Weight216.26 g/mol
Exact Mass216.06
IUPAC Name2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid
SMILESCC(C)SCc1noc(CC(=O)O)n1
InChIInChI=1S/C8H12N2O3S/c1-5(2)14-4-6-9-7(13-10-6)3-8(11)12/h5H,3-4H2,1-2H3,(H,11,12)
InChIKeyPLROFMFRCWQEPQ-UHFFFAOYSA-N
XLogP1.34
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.26
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
The IUPAC name of 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid (CID 65134331) is 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid is CC(C)SCc1noc(CC(=O)O)n1.
What is the InChIKey of 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
The InChIKey is PLROFMFRCWQEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3S/c1-5(2)14-4-6-9-7(13-10-6)3-8(11)12/h5H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid has a molecular weight of 216.26 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(propan-2-ylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]acetic acid is sourced from PubChem (CID 65134331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).