2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid

C8H13N3O3 — CID 115345512

IUPAC2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid
SMILESCN(C)CCc1noc(CC(=O)O)n1
InChIInChI=1S/C8H13N3O3/c1-11(2)4-3-6-9-7(14-10-6)5-8(12)13/h3-5H2,1-2H3,(H,12,13)
InChIKeyPEPVTMNQPMVEJR-UHFFFAOYSA-N
MW199.21 g/mol
LogP-0.20
Rot. Bonds5

About 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid

2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 115345512) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid
PubChem CID115345512
Molecular FormulaC8H13N3O3
Molecular Weight199.21 g/mol
Exact Mass199.10
IUPAC Name2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid
SMILESCN(C)CCc1noc(CC(=O)O)n1
InChIInChI=1S/C8H13N3O3/c1-11(2)4-3-6-9-7(14-10-6)5-8(12)13/h3-5H2,1-2H3,(H,12,13)
InChIKeyPEPVTMNQPMVEJR-UHFFFAOYSA-N
XLogP-0.20
TPSA79.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 5-0.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The IUPAC name of 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid (CID 115345512) is 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid is CN(C)CCc1noc(CC(=O)O)n1.
What is the InChIKey of 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The InChIKey is PEPVTMNQPMVEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-11(2)4-3-6-9-7(14-10-6)5-8(12)13/h3-5H2,1-2H3,(H,12,13).
What are the key properties of 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid has a molecular weight of 199.21 g/mol, XLogP of -0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid is sourced from PubChem (CID 115345512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).