2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid

C12H11FN2O4 — CID 94695032

IUPAC2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid
SMILESO=C(O)Cc1nc(CCOc2ccc(F)cc2)no1
InChIInChI=1S/C12H11FN2O4/c13-8-1-3-9(4-2-8)18-6-5-10-14-11(19-15-10)7-12(16)17/h1-4H,5-7H2,(H,16,17)
InChIKeyQBXNTZQVDBSOJT-UHFFFAOYSA-N
MW266.23 g/mol
LogP1.46
Rot. Bonds6

About 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid

2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 94695032) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid
PubChem CID94695032
Molecular FormulaC12H11FN2O4
Molecular Weight266.23 g/mol
Exact Mass266.07
IUPAC Name2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid
SMILESO=C(O)Cc1nc(CCOc2ccc(F)cc2)no1
InChIInChI=1S/C12H11FN2O4/c13-8-1-3-9(4-2-8)18-6-5-10-14-11(19-15-10)7-12(16)17/h1-4H,5-7H2,(H,16,17)
InChIKeyQBXNTZQVDBSOJT-UHFFFAOYSA-N
XLogP1.46
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.23
LogP ≤ 51.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The IUPAC name of 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid (CID 94695032) is 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid is O=C(O)Cc1nc(CCOc2ccc(F)cc2)no1.
What is the InChIKey of 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The InChIKey is QBXNTZQVDBSOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O4/c13-8-1-3-9(4-2-8)18-6-5-10-14-11(19-15-10)7-12(16)17/h1-4H,5-7H2,(H,16,17).
What are the key properties of 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid?
2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid has a molecular weight of 266.23 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(4-fluorophenoxy)ethyl]-1,2,4-oxadiazol-5-yl]acetic acid is sourced from PubChem (CID 94695032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).