C9H17N3O2 — CID 65094639
2-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N-methylethanamine (PubChem CID 65094639) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N-methylethanamine.
| Compound Name | 2-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 65094639 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N-methylethanamine |
| SMILES | CNCCc1nc(CCCOC)no1 |
| InChI | InChI=1S/C9H17N3O2/c1-10-6-5-9-11-8(12-14-9)4-3-7-13-2/h10H,3-7H2,1-2H3 |
| InChIKey | HKQBWMMRCYLUKO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|