About ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate
ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate (PubChem CID 79475312) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate.
Analyze ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate?
The IUPAC name of ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate (CID 79475312) is ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate.
What is the SMILES notation for ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate?
The canonical SMILES for ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate is CCOC(=O)Cc1nc(CCOC)no1.
What is the InChIKey of ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate?
The InChIKey is GJRHXHBSJPNYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-3-14-9(12)6-8-10-7(11-15-8)4-5-13-2/h3-6H2,1-2H3.
What are the key properties of ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate?
ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate has a molecular weight of 214.22 g/mol, XLogP of 0.36, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]acetate is sourced from PubChem (CID 79475312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).