About methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate
methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate (PubChem CID 79474749) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate.
Analyze methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
The IUPAC name of methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate (CID 79474749) is methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate.
What is the SMILES notation for methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
The canonical SMILES for methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate is COCc1noc(CC(=O)OC)n1.
What is the InChIKey of methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
The InChIKey is ZMGAORCOQQFKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-11-4-5-8-6(13-9-5)3-7(10)12-2/h3-4H2,1-2H3.
What are the key properties of methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate has a molecular weight of 186.17 g/mol, XLogP of -0.07, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate is sourced from PubChem (CID 79474749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).