C9H14N2O3 — CID 79004032
ethyl 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)acetate (PubChem CID 79004032) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)acetate.
| Compound Name | ethyl 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)acetate |
|---|---|
| PubChem CID | 79004032 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethyl 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)acetate |
| SMILES | CCOC(=O)Cc1nc(C(C)C)no1 |
| InChI | InChI=1S/C9H14N2O3/c1-4-13-8(12)5-7-10-9(6(2)3)11-14-7/h6H,4-5H2,1-3H3 |
| InChIKey | KJPDYIDXMBLPKJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |