C15H18N2O4 — CID 60721315
ethyl 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoate (PubChem CID 60721315) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoate.
| Compound Name | ethyl 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 60721315 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCc2nc(C(C)C)no2)cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-4-19-15(18)11-5-7-12(8-6-11)20-9-13-16-14(10(2)3)17-21-13/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | VYXPTPLXGUURNR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |