C13H14N2O3 — CID 30029227
4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde (PubChem CID 30029227) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde.
| Compound Name | 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 30029227 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde |
| SMILES | CC(C)c1noc(COc2ccc(C=O)cc2)n1 |
| InChI | InChI=1S/C13H14N2O3/c1-9(2)13-14-12(18-15-13)8-17-11-5-3-10(7-16)4-6-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | VJJKOQZIARKPMQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|