C14H10N2O3S — CID 32758594
4-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde (PubChem CID 32758594) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde.
| Compound Name | 4-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 32758594 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCc2nc(-c3ccsc3)no2)cc1 |
| InChI | InChI=1S/C14H10N2O3S/c17-7-10-1-3-12(4-2-10)18-8-13-15-14(16-19-13)11-5-6-20-9-11/h1-7,9H,8H2 |
| InChIKey | SGYUVVNDYRCZJD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|