C17H12F2N2O4 — CID 97058054
4-[[3-[3-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde (PubChem CID 97058054) has the molecular formula C17H12F2N2O4 and a molecular weight of 346.29 g/mol. Its IUPAC name is 4-[[3-[3-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde.
| Compound Name | 4-[[3-[3-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 97058054 |
| Molecular Formula | C17H12F2N2O4 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[[3-[3-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCc2nc(-c3cccc(OC(F)F)c3)no2)cc1 |
| InChI | InChI=1S/C17H12F2N2O4/c18-17(19)24-14-3-1-2-12(8-14)16-20-15(25-21-16)10-23-13-6-4-11(9-22)5-7-13/h1-9,17H,10H2 |
| InChIKey | SBMZYBHOFKUPND-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|