C17H11F3N2O3 — CID 97058040
3-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde (PubChem CID 97058040) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 3-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde.
| Compound Name | 3-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 97058040 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1cccc(OCc2nc(-c3ccccc3C(F)(F)F)no2)c1 |
| InChI | InChI=1S/C17H11F3N2O3/c18-17(19,20)14-7-2-1-6-13(14)16-21-15(25-22-16)10-24-12-5-3-4-11(8-12)9-23/h1-9H,10H2 |
| InChIKey | PZEPWDSGROKMMW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|